C19H21Cl2FN2O — CID 42919391
2,4-dichloro-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-5-fluorobenzamide (PubChem CID 42919391) has the molecular formula C19H21Cl2FN2O and a molecular weight of 383.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 42919391 |
| Molecular Formula | C19H21Cl2FN2O |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2,4-dichloro-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-5-fluorobenzamide |
| SMILES | CCc1ccc(C(CNC(=O)c2cc(F)c(Cl)cc2Cl)N(C)C)cc1 |
| InChI | InChI=1S/C19H21Cl2FN2O/c1-4-12-5-7-13(8-6-12)18(24(2)3)11-23-19(25)14-9-17(22)16(21)10-15(14)20/h5-10,18H,4,11H2,1-3H3,(H,23,25) |
| InChIKey | YRKANCQSWZBDFF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|