C15H12Cl2FNO3 — CID 111116203
2,4-dichloro-5-fluoro-N-[4-(2-hydroxyethoxy)phenyl]benzamide (PubChem CID 111116203) has the molecular formula C15H12Cl2FNO3 and a molecular weight of 344.17 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[4-(2-hydroxyethoxy)phenyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[4-(2-hydroxyethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 111116203 |
| Molecular Formula | C15H12Cl2FNO3 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[4-(2-hydroxyethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OCCO)cc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FNO3/c16-12-8-13(17)14(18)7-11(12)15(21)19-9-1-3-10(4-2-9)22-6-5-20/h1-4,7-8,20H,5-6H2,(H,19,21) |
| InChIKey | MBNSQEBTYRGUHR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|