C7H13FN2O5S — CID 22610610
4-fluoro-6-methylbenzene-1,3-diamine;sulfuric acid;hydrate (PubChem CID 22610610) has the molecular formula C7H13FN2O5S and a molecular weight of 256.25 g/mol. Its IUPAC name is 4-fluoro-6-methylbenzene-1,3-diamine;sulfuric acid;hydrate.
| Compound Name | 4-fluoro-6-methylbenzene-1,3-diamine;sulfuric acid;hydrate |
|---|---|
| PubChem CID | 22610610 |
| Molecular Formula | C7H13FN2O5S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-fluoro-6-methylbenzene-1,3-diamine;sulfuric acid;hydrate |
| SMILES | Cc1cc(F)c(N)cc1N.O.O=S(=O)(O)O |
| InChI | InChI=1S/C7H9FN2.H2O4S.H2O/c1-4-2-5(8)7(10)3-6(4)9;1-5(2,3)4;/h2-3H,9-10H2,1H3;(H2,1,2,3,4);1H2 |
| InChIKey | BMILFOGBNXCWMP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 158.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|