C8H15NO5S — CID 131846787
2,4-dimethylaniline;sulfuric acid;hydrate (PubChem CID 131846787) has the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2,4-dimethylaniline;sulfuric acid;hydrate.
| Compound Name | 2,4-dimethylaniline;sulfuric acid;hydrate |
|---|---|
| PubChem CID | 131846787 |
| Molecular Formula | C8H15NO5S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2,4-dimethylaniline;sulfuric acid;hydrate |
| SMILES | Cc1ccc(N)c(C)c1.O.O=S(=O)(O)O |
| InChI | InChI=1S/C8H11N.H2O4S.H2O/c1-6-3-4-8(9)7(2)5-6;1-5(2,3)4;/h3-5H,9H2,1-2H3;(H2,1,2,3,4);1H2 |
| InChIKey | TTXHHWRVBYBHAC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|