C8H10N2S — CID 123917345
2,4-dimethyl-6-thionitrosoaniline (PubChem CID 123917345) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is 2,4-dimethyl-6-thionitrosoaniline.
| Compound Name | 2,4-dimethyl-6-thionitrosoaniline |
|---|---|
| PubChem CID | 123917345 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2,4-dimethyl-6-thionitrosoaniline |
| SMILES | Cc1cc(C)c(N)c(N=S)c1 |
| InChI | InChI=1S/C8H10N2S/c1-5-3-6(2)8(9)7(4-5)10-11/h3-4H,9H2,1-2H3 |
| InChIKey | PFKZAGJHYAQHMJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|