C9H11FS — CID 130850117
2-fluoro-1,5-dimethyl-3-methylsulfanylbenzene (PubChem CID 130850117) has the molecular formula C9H11FS and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-fluoro-1,5-dimethyl-3-methylsulfanylbenzene.
| Compound Name | 2-fluoro-1,5-dimethyl-3-methylsulfanylbenzene |
|---|---|
| PubChem CID | 130850117 |
| Molecular Formula | C9H11FS |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-fluoro-1,5-dimethyl-3-methylsulfanylbenzene |
| SMILES | CSc1cc(C)cc(C)c1F |
| InChI | InChI=1S/C9H11FS/c1-6-4-7(2)9(10)8(5-6)11-3/h4-5H,1-3H3 |
| InChIKey | RRJHKCNVBXIHOP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |