C9H11ClF2NP — CID 143122501
2-chloro-6-[difluoro(phosphanyl)methyl]-N,4-dimethylaniline (PubChem CID 143122501) has the molecular formula C9H11ClF2NP and a molecular weight of 237.62 g/mol. Its IUPAC name is 2-chloro-6-[difluoro(phosphanyl)methyl]-N,4-dimethylaniline.
| Compound Name | 2-chloro-6-[difluoro(phosphanyl)methyl]-N,4-dimethylaniline |
|---|---|
| PubChem CID | 143122501 |
| Molecular Formula | C9H11ClF2NP |
| Molecular Weight | 237.62 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-chloro-6-[difluoro(phosphanyl)methyl]-N,4-dimethylaniline |
| SMILES | CNc1c(Cl)cc(C)cc1C(F)(F)P |
| InChI | InChI=1S/C9H11ClF2NP/c1-5-3-6(9(11,12)14)8(13-2)7(10)4-5/h3-4,13H,14H2,1-2H3 |
| InChIKey | AILCKTWPBAKFLE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|