C11H14F2NP — CID 176942982
6-[difluoro(phosphanyl)methyl]-2-ethenyl-N,3-dimethylaniline (PubChem CID 176942982) has the molecular formula C11H14F2NP and a molecular weight of 229.21 g/mol. Its IUPAC name is 6-[difluoro(phosphanyl)methyl]-2-ethenyl-N,3-dimethylaniline.
| Compound Name | 6-[difluoro(phosphanyl)methyl]-2-ethenyl-N,3-dimethylaniline |
|---|---|
| PubChem CID | 176942982 |
| Molecular Formula | C11H14F2NP |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 6-[difluoro(phosphanyl)methyl]-2-ethenyl-N,3-dimethylaniline |
| SMILES | C=Cc1c(C)ccc(C(F)(F)P)c1NC |
| InChI | InChI=1S/C11H14F2NP/c1-4-8-7(2)5-6-9(10(8)14-3)11(12,13)15/h4-6,14H,1,15H2,2-3H3 |
| InChIKey | XEQLLTHJLJRSSS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|