C10H11F3N2 — CID 143901601
2-methanimidoyl-N,3-dimethyl-6-(trifluoromethyl)aniline (PubChem CID 143901601) has the molecular formula C10H11F3N2 and a molecular weight of 216.21 g/mol. Its IUPAC name is 2-methanimidoyl-N,3-dimethyl-6-(trifluoromethyl)aniline.
| Compound Name | 2-methanimidoyl-N,3-dimethyl-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 143901601 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-methanimidoyl-N,3-dimethyl-6-(trifluoromethyl)aniline |
| SMILES | [H]/N=C/c1c(C)ccc(C(F)(F)F)c1NC |
| InChI | InChI=1S/C10H11F3N2/c1-6-3-4-8(10(11,12)13)9(15-2)7(6)5-14/h3-5,14-15H,1-2H3/b14-5+ |
| InChIKey | DUWYUGXWLSUPAP-LHHJGKSTSA-N |
| XLogP | 3.05 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|