C10H10F5NO — CID 54485278
(NZ)-N-[[2,3-dimethyl-6-(trifluoromethyl)phenyl]methylidene]hydroxylamine;molecular fluorine (PubChem CID 54485278) has the molecular formula C10H10F5NO and a molecular weight of 255.19 g/mol. Its IUPAC name is (NZ)-N-[[2,3-dimethyl-6-(trifluoromethyl)phenyl]methylidene]hydroxylamine;molecular fluorine.
| Compound Name | (NZ)-N-[[2,3-dimethyl-6-(trifluoromethyl)phenyl]methylidene]hydroxylamine;molecular fluorine |
|---|---|
| PubChem CID | 54485278 |
| Molecular Formula | C10H10F5NO |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (NZ)-N-[[2,3-dimethyl-6-(trifluoromethyl)phenyl]methylidene]hydroxylamine;molecular fluorine |
| SMILES | Cc1ccc(C(F)(F)F)c(/C=N\O)c1C.FF |
| InChI | InChI=1S/C10H10F3NO.F2/c1-6-3-4-9(10(11,12)13)8(5-14-15)7(6)2;1-2/h3-5,15H,1-2H3;/b14-5-; |
| InChIKey | XRWCGEOWEZUMLB-MFGIPTIESA-N |
| XLogP | 3.97 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|