C10H13F3O3S2 — CID 175799159
trifluoromethanesulfonic acid;2,3,4-trimethylbenzenethiol (PubChem CID 175799159) has the molecular formula C10H13F3O3S2 and a molecular weight of 302.34 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;2,3,4-trimethylbenzenethiol.
| Compound Name | trifluoromethanesulfonic acid;2,3,4-trimethylbenzenethiol |
|---|---|
| PubChem CID | 175799159 |
| Molecular Formula | C10H13F3O3S2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | trifluoromethanesulfonic acid;2,3,4-trimethylbenzenethiol |
| SMILES | Cc1ccc(S)c(C)c1C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H12S.CHF3O3S/c1-6-4-5-9(10)8(3)7(6)2;2-1(3,4)8(5,6)7/h4-5,10H,1-3H3;(H,5,6,7) |
| InChIKey | XAHYEPPIVAPBJD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|