C16H25F3O6S2 — CID 171929783
trifluoromethanesulfonic acid;2,3,4-tri(propan-2-yloxy)benzenethiol (PubChem CID 171929783) has the molecular formula C16H25F3O6S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;2,3,4-tri(propan-2-yloxy)benzenethiol.
| Compound Name | trifluoromethanesulfonic acid;2,3,4-tri(propan-2-yloxy)benzenethiol |
|---|---|
| PubChem CID | 171929783 |
| Molecular Formula | C16H25F3O6S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | trifluoromethanesulfonic acid;2,3,4-tri(propan-2-yloxy)benzenethiol |
| SMILES | CC(C)Oc1ccc(S)c(OC(C)C)c1OC(C)C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C15H24O3S.CHF3O3S/c1-9(2)16-12-7-8-13(19)15(18-11(5)6)14(12)17-10(3)4;2-1(3,4)8(5,6)7/h7-11,19H,1-6H3;(H,5,6,7) |
| InChIKey | IRTXUFYSXIYESX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|