C9H7F3N2O2 — CID 176942167
3-amino-2-methanimidoyl-4-(trifluoromethyl)benzoic acid (PubChem CID 176942167) has the molecular formula C9H7F3N2O2 and a molecular weight of 232.16 g/mol. Its IUPAC name is 3-amino-2-methanimidoyl-4-(trifluoromethyl)benzoic acid.
| Compound Name | 3-amino-2-methanimidoyl-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 176942167 |
| Molecular Formula | C9H7F3N2O2 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-amino-2-methanimidoyl-4-(trifluoromethyl)benzoic acid |
| SMILES | [H]/N=C/c1c(C(=O)O)ccc(C(F)(F)F)c1N |
| InChI | InChI=1S/C9H7F3N2O2/c10-9(11,12)6-2-1-4(8(15)16)5(3-13)7(6)14/h1-3,13H,14H2,(H,15,16)/b13-3+ |
| InChIKey | LCMITEMAOGUXQI-QLKAYGNNSA-N |
| XLogP | 1.98 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|