C9H8ClF3N2O — CID 171013772
2-chloro-1-[2,3-diamino-4-(trifluoromethyl)phenyl]ethanone (PubChem CID 171013772) has the molecular formula C9H8ClF3N2O and a molecular weight of 252.62 g/mol. Its IUPAC name is 2-chloro-1-[2,3-diamino-4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-chloro-1-[2,3-diamino-4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171013772 |
| Molecular Formula | C9H8ClF3N2O |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 2-chloro-1-[2,3-diamino-4-(trifluoromethyl)phenyl]ethanone |
| SMILES | Nc1c(C(=O)CCl)ccc(C(F)(F)F)c1N |
| InChI | InChI=1S/C9H8ClF3N2O/c10-3-6(16)4-1-2-5(9(11,12)13)8(15)7(4)14/h1-2H,3,14-15H2 |
| InChIKey | JLXWLVPMOAIYQA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|