C15H15F3N4O2 — CID 175983977
tert-butyl N-[5-[3-(trifluoromethyl)-2-pyridinyl]pyrazin-2-yl]carbamate (PubChem CID 175983977) has the molecular formula C15H15F3N4O2 and a molecular weight of 340.31 g/mol. Its IUPAC name is tert-butyl N-[5-[3-(trifluoromethyl)-2-pyridinyl]pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[3-(trifluoromethyl)-2-pyridinyl]pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 175983977 |
| Molecular Formula | C15H15F3N4O2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | tert-butyl N-[5-[3-(trifluoromethyl)-2-pyridinyl]pyrazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(-c2ncccc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H15F3N4O2/c1-14(2,3)24-13(23)22-11-8-20-10(7-21-11)12-9(15(16,17)18)5-4-6-19-12/h4-8H,1-3H3,(H,21,22,23) |
| InChIKey | IRLYHDHMTUGOOZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |