C16H25N3O3Se — CID 171564447
tert-butyl N-[2-methyl-1-[(3-methylselanyl-2-pyridinyl)methylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 171564447) has the molecular formula C16H25N3O3Se and a molecular weight of 386.35 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[(3-methylselanyl-2-pyridinyl)methylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[(3-methylselanyl-2-pyridinyl)methylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 171564447 |
| Molecular Formula | C16H25N3O3Se |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[(3-methylselanyl-2-pyridinyl)methylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[Se]c1cccnc1CNC(=O)C(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N3O3Se/c1-15(2,3)22-14(21)19-16(4,5)13(20)18-10-11-12(23-6)8-7-9-17-11/h7-9H,10H2,1-6H3,(H,18,20)(H,19,21) |
| InChIKey | MNBQZXDQOIDNPX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|