C12H17N3O3Se — CID 174235416
[2-methyl-1-[(3-methylselanyl-2-pyridinyl)methylamino]-1-oxopropan-2-yl]carbamic acid (PubChem CID 174235416) has the molecular formula C12H17N3O3Se and a molecular weight of 330.25 g/mol. Its IUPAC name is [2-methyl-1-[(3-methylselanyl-2-pyridinyl)methylamino]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [2-methyl-1-[(3-methylselanyl-2-pyridinyl)methylamino]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174235416 |
| Molecular Formula | C12H17N3O3Se |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [2-methyl-1-[(3-methylselanyl-2-pyridinyl)methylamino]-1-oxopropan-2-yl]carbamic acid |
| SMILES | C[Se]c1cccnc1CNC(=O)C(C)(C)NC(=O)O |
| InChI | InChI=1S/C12H17N3O3Se/c1-12(2,15-11(17)18)10(16)14-7-8-9(19-3)5-4-6-13-8/h4-6,15H,7H2,1-3H3,(H,14,16)(H,17,18) |
| InChIKey | YSLMMIKWTVVKLS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|