C15H21F3N2O4S — CID 175695524
2-(dimethylsulfamoyl)-4-(6,6,6-trifluorohexylamino)benzoic acid (PubChem CID 175695524) has the molecular formula C15H21F3N2O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-(dimethylsulfamoyl)-4-(6,6,6-trifluorohexylamino)benzoic acid.
| Compound Name | 2-(dimethylsulfamoyl)-4-(6,6,6-trifluorohexylamino)benzoic acid |
|---|---|
| PubChem CID | 175695524 |
| Molecular Formula | C15H21F3N2O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-(dimethylsulfamoyl)-4-(6,6,6-trifluorohexylamino)benzoic acid |
| SMILES | CN(C)S(=O)(=O)c1cc(NCCCCCC(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C15H21F3N2O4S/c1-20(2)25(23,24)13-10-11(6-7-12(13)14(21)22)19-9-5-3-4-8-15(16,17)18/h6-7,10,19H,3-5,8-9H2,1-2H3,(H,21,22) |
| InChIKey | SKUBVOBABYWARG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|