C20H31F3N2O5S — CID 155167999
methyl 5-(dimethylsulfamoyl)-2-ethoxy-4-(8,8,8-trifluorooctylamino)benzoate (PubChem CID 155167999) has the molecular formula C20H31F3N2O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is methyl 5-(dimethylsulfamoyl)-2-ethoxy-4-(8,8,8-trifluorooctylamino)benzoate.
| Compound Name | methyl 5-(dimethylsulfamoyl)-2-ethoxy-4-(8,8,8-trifluorooctylamino)benzoate |
|---|---|
| PubChem CID | 155167999 |
| Molecular Formula | C20H31F3N2O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | methyl 5-(dimethylsulfamoyl)-2-ethoxy-4-(8,8,8-trifluorooctylamino)benzoate |
| SMILES | CCOc1cc(NCCCCCCCC(F)(F)F)c(S(=O)(=O)N(C)C)cc1C(=O)OC |
| InChI | InChI=1S/C20H31F3N2O5S/c1-5-30-17-14-16(24-12-10-8-6-7-9-11-20(21,22)23)18(31(27,28)25(2)3)13-15(17)19(26)29-4/h13-14,24H,5-12H2,1-4H3 |
| InChIKey | JIIDAGDTIJWKHH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|