C19H29F3N2O5S — CID 175695359
methyl 3-(dimethylsulfamoyl)-2-methoxy-4-(8,8,8-trifluorooctylamino)benzoate (PubChem CID 175695359) has the molecular formula C19H29F3N2O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is methyl 3-(dimethylsulfamoyl)-2-methoxy-4-(8,8,8-trifluorooctylamino)benzoate.
| Compound Name | methyl 3-(dimethylsulfamoyl)-2-methoxy-4-(8,8,8-trifluorooctylamino)benzoate |
|---|---|
| PubChem CID | 175695359 |
| Molecular Formula | C19H29F3N2O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | methyl 3-(dimethylsulfamoyl)-2-methoxy-4-(8,8,8-trifluorooctylamino)benzoate |
| SMILES | COC(=O)c1ccc(NCCCCCCCC(F)(F)F)c(S(=O)(=O)N(C)C)c1OC |
| InChI | InChI=1S/C19H29F3N2O5S/c1-24(2)30(26,27)17-15(11-10-14(16(17)28-3)18(25)29-4)23-13-9-7-5-6-8-12-19(20,21)22/h10-11,23H,5-9,12-13H2,1-4H3 |
| InChIKey | IEKAQJZPHVJZTC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|