C13H17F3N2O4S — CID 177315533
methyl 5-(methylsulfamoyl)-2-(4,4,4-trifluorobutylamino)benzoate (PubChem CID 177315533) has the molecular formula C13H17F3N2O4S and a molecular weight of 354.35 g/mol. Its IUPAC name is methyl 5-(methylsulfamoyl)-2-(4,4,4-trifluorobutylamino)benzoate.
| Compound Name | methyl 5-(methylsulfamoyl)-2-(4,4,4-trifluorobutylamino)benzoate |
|---|---|
| PubChem CID | 177315533 |
| Molecular Formula | C13H17F3N2O4S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | methyl 5-(methylsulfamoyl)-2-(4,4,4-trifluorobutylamino)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(NCCCC(F)(F)F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C13H17F3N2O4S/c1-17-23(20,21)9-4-5-11(10(8-9)12(19)22-2)18-7-3-6-13(14,15)16/h4-5,8,17-18H,3,6-7H2,1-2H3 |
| InChIKey | YQWKCWJXCSWVLA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|