C18H27F3N2O5S — CID 155168044
5-(dimethylsulfamoyl)-2-methoxy-4-(8,8,8-trifluorooctylamino)benzoic acid (PubChem CID 155168044) has the molecular formula C18H27F3N2O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-methoxy-4-(8,8,8-trifluorooctylamino)benzoic acid.
| Compound Name | 5-(dimethylsulfamoyl)-2-methoxy-4-(8,8,8-trifluorooctylamino)benzoic acid |
|---|---|
| PubChem CID | 155168044 |
| Molecular Formula | C18H27F3N2O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-methoxy-4-(8,8,8-trifluorooctylamino)benzoic acid |
| SMILES | COc1cc(NCCCCCCCC(F)(F)F)c(S(=O)(=O)N(C)C)cc1C(=O)O |
| InChI | InChI=1S/C18H27F3N2O5S/c1-23(2)29(26,27)16-11-13(17(24)25)15(28-3)12-14(16)22-10-8-6-4-5-7-9-18(19,20)21/h11-12,22H,4-10H2,1-3H3,(H,24,25) |
| InChIKey | WMFXOROMJKWFBD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|