C15H17F3O7S — CID 156504148
methyl 2-ethoxy-4-[3-(trifluoromethylsulfonyloxy)cyclobutyl]oxybenzoate (PubChem CID 156504148) has the molecular formula C15H17F3O7S and a molecular weight of 398.36 g/mol. Its IUPAC name is methyl 2-ethoxy-4-[3-(trifluoromethylsulfonyloxy)cyclobutyl]oxybenzoate.
| Compound Name | methyl 2-ethoxy-4-[3-(trifluoromethylsulfonyloxy)cyclobutyl]oxybenzoate |
|---|---|
| PubChem CID | 156504148 |
| Molecular Formula | C15H17F3O7S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | methyl 2-ethoxy-4-[3-(trifluoromethylsulfonyloxy)cyclobutyl]oxybenzoate |
| SMILES | CCOc1cc(OC2CC(OS(=O)(=O)C(F)(F)F)C2)ccc1C(=O)OC |
| InChI | InChI=1S/C15H17F3O7S/c1-3-23-13-8-9(4-5-12(13)14(19)22-2)24-10-6-11(7-10)25-26(20,21)15(16,17)18/h4-5,8,10-11H,3,6-7H2,1-2H3 |
| InChIKey | GAOGDCBMASECAW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|