C12H11F2N3O3 — CID 114291571
2-cyano-N-(2,4-difluoro-5-nitrophenyl)-2-methylbutanamide (PubChem CID 114291571) has the molecular formula C12H11F2N3O3 and a molecular weight of 283.23 g/mol. Its IUPAC name is 2-cyano-N-(2,4-difluoro-5-nitrophenyl)-2-methylbutanamide.
| Compound Name | 2-cyano-N-(2,4-difluoro-5-nitrophenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 114291571 |
| Molecular Formula | C12H11F2N3O3 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-cyano-N-(2,4-difluoro-5-nitrophenyl)-2-methylbutanamide |
| SMILES | CCC(C)(C#N)C(=O)Nc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C12H11F2N3O3/c1-3-12(2,6-15)11(18)16-9-5-10(17(19)20)8(14)4-7(9)13/h4-5H,3H2,1-2H3,(H,16,18) |
| InChIKey | ASSWSJQSKWFIJQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|