C14H10BrF3N2S — CID 102837222
2-[(4-bromo-5-methylthiophen-2-yl)methylamino]-5-(trifluoromethyl)benzonitrile (PubChem CID 102837222) has the molecular formula C14H10BrF3N2S and a molecular weight of 375.21 g/mol. Its IUPAC name is 2-[(4-bromo-5-methylthiophen-2-yl)methylamino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[(4-bromo-5-methylthiophen-2-yl)methylamino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 102837222 |
| Molecular Formula | C14H10BrF3N2S |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 2-[(4-bromo-5-methylthiophen-2-yl)methylamino]-5-(trifluoromethyl)benzonitrile |
| SMILES | Cc1sc(CNc2ccc(C(F)(F)F)cc2C#N)cc1Br |
| InChI | InChI=1S/C14H10BrF3N2S/c1-8-12(15)5-11(21-8)7-20-13-3-2-10(14(16,17)18)4-9(13)6-19/h2-5,20H,7H2,1H3 |
| InChIKey | XJFIQXVUAKYYLJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |