C16H13F3N2 — CID 107926869
5-methyl-2-[[3-(trifluoromethyl)phenyl]methylamino]benzonitrile (PubChem CID 107926869) has the molecular formula C16H13F3N2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 5-methyl-2-[[3-(trifluoromethyl)phenyl]methylamino]benzonitrile.
| Compound Name | 5-methyl-2-[[3-(trifluoromethyl)phenyl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 107926869 |
| Molecular Formula | C16H13F3N2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 5-methyl-2-[[3-(trifluoromethyl)phenyl]methylamino]benzonitrile |
| SMILES | Cc1ccc(NCc2cccc(C(F)(F)F)c2)c(C#N)c1 |
| InChI | InChI=1S/C16H13F3N2/c1-11-5-6-15(13(7-11)9-20)21-10-12-3-2-4-14(8-12)16(17,18)19/h2-8,21H,10H2,1H3 |
| InChIKey | GYJPZZHHPBLWKP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |