C14H11F3N4 — CID 107543356
6-methyl-2-[[3-(trifluoromethyl)phenyl]methylamino]pyrimidine-4-carbonitrile (PubChem CID 107543356) has the molecular formula C14H11F3N4 and a molecular weight of 292.26 g/mol. Its IUPAC name is 6-methyl-2-[[3-(trifluoromethyl)phenyl]methylamino]pyrimidine-4-carbonitrile.
| Compound Name | 6-methyl-2-[[3-(trifluoromethyl)phenyl]methylamino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107543356 |
| Molecular Formula | C14H11F3N4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 6-methyl-2-[[3-(trifluoromethyl)phenyl]methylamino]pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NCc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H11F3N4/c1-9-5-12(7-18)21-13(20-9)19-8-10-3-2-4-11(6-10)14(15,16)17/h2-6H,8H2,1H3,(H,19,20,21) |
| InChIKey | XKQBKNAQNALZLS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |