C15H15ClN4O — CID 176947867
5-[(5-chloro-2-methylpyrimidin-4-yl)amino]-1-ethyl-3H-indol-2-one (PubChem CID 176947867) has the molecular formula C15H15ClN4O and a molecular weight of 302.77 g/mol. Its IUPAC name is 5-[(5-chloro-2-methylpyrimidin-4-yl)amino]-1-ethyl-3H-indol-2-one.
| Compound Name | 5-[(5-chloro-2-methylpyrimidin-4-yl)amino]-1-ethyl-3H-indol-2-one |
|---|---|
| PubChem CID | 176947867 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-[(5-chloro-2-methylpyrimidin-4-yl)amino]-1-ethyl-3H-indol-2-one |
| SMILES | CCN1C(=O)Cc2cc(Nc3nc(C)ncc3Cl)ccc21 |
| InChI | InChI=1S/C15H15ClN4O/c1-3-20-13-5-4-11(6-10(13)7-14(20)21)19-15-12(16)8-17-9(2)18-15/h4-6,8H,3,7H2,1-2H3,(H,17,18,19) |
| InChIKey | DGLYROHBOXJTNE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |