C19H19ClN2OS — CID 168579677
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(3-phenylpropoxy)aniline (PubChem CID 168579677) has the molecular formula C19H19ClN2OS and a molecular weight of 358.89 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(3-phenylpropoxy)aniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(3-phenylpropoxy)aniline |
|---|---|
| PubChem CID | 168579677 |
| Molecular Formula | C19H19ClN2OS |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(3-phenylpropoxy)aniline |
| SMILES | Clc1ncc(CNc2cccc(OCCCc3ccccc3)c2)s1 |
| InChI | InChI=1S/C19H19ClN2OS/c20-19-22-14-18(24-19)13-21-16-9-4-10-17(12-16)23-11-5-8-15-6-2-1-3-7-15/h1-4,6-7,9-10,12,14,21H,5,8,11,13H2 |
| InChIKey | PXEKHBHRHJLPRI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|