C15H11ClN2O4 — CID 24772600
N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenoxy]-N-hydroxyacetamide (PubChem CID 24772600) has the molecular formula C15H11ClN2O4 and a molecular weight of 318.72 g/mol. Its IUPAC name is N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenoxy]-N-hydroxyacetamide.
| Compound Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenoxy]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 24772600 |
| Molecular Formula | C15H11ClN2O4 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenoxy]-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)Oc1ccc(-c2nc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C15H11ClN2O4/c1-9(19)18(20)22-12-5-2-10(3-6-12)15-17-13-8-11(16)4-7-14(13)21-15/h2-8,20H,1H3 |
| InChIKey | IWUCARIIYRDCOU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|