C15H11Br2NO — CID 50880177
2-(3,5-dibromo-4-methylphenyl)-5-methyl-1,3-benzoxazole (PubChem CID 50880177) has the molecular formula C15H11Br2NO and a molecular weight of 381.07 g/mol. Its IUPAC name is 2-(3,5-dibromo-4-methylphenyl)-5-methyl-1,3-benzoxazole.
| Compound Name | 2-(3,5-dibromo-4-methylphenyl)-5-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 50880177 |
| Molecular Formula | C15H11Br2NO |
| Molecular Weight | 381.07 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | 2-(3,5-dibromo-4-methylphenyl)-5-methyl-1,3-benzoxazole |
| SMILES | Cc1ccc2oc(-c3cc(Br)c(C)c(Br)c3)nc2c1 |
| InChI | InChI=1S/C15H11Br2NO/c1-8-3-4-14-13(5-8)18-15(19-14)10-6-11(16)9(2)12(17)7-10/h3-7H,1-2H3 |
| InChIKey | RRWPIXYZVRIJDS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.07 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |