C18H21Cl2N3O2 — CID 23134641
methyl 5-[4-(2-aminopropan-2-yl)phenyl]-1H-indazole-3-carboxylate;dihydrochloride (PubChem CID 23134641) has the molecular formula C18H21Cl2N3O2 and a molecular weight of 382.29 g/mol. Its IUPAC name is methyl 5-[4-(2-aminopropan-2-yl)phenyl]-1H-indazole-3-carboxylate;dihydrochloride.
| Compound Name | methyl 5-[4-(2-aminopropan-2-yl)phenyl]-1H-indazole-3-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 23134641 |
| Molecular Formula | C18H21Cl2N3O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl 5-[4-(2-aminopropan-2-yl)phenyl]-1H-indazole-3-carboxylate;dihydrochloride |
| SMILES | COC(=O)c1n[nH]c2ccc(-c3ccc(C(C)(C)N)cc3)cc12.Cl.Cl |
| InChI | InChI=1S/C18H19N3O2.2ClH/c1-18(2,19)13-7-4-11(5-8-13)12-6-9-15-14(10-12)16(21-20-15)17(22)23-3;;/h4-10H,19H2,1-3H3,(H,20,21);2*1H |
| InChIKey | NGGJDAPCQIBIIF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |