C17H16N4 — CID 11425869
5-[4-(2-aminopropan-2-yl)phenyl]-1H-indazole-3-carbonitrile (PubChem CID 11425869) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-[4-(2-aminopropan-2-yl)phenyl]-1H-indazole-3-carbonitrile.
| Compound Name | 5-[4-(2-aminopropan-2-yl)phenyl]-1H-indazole-3-carbonitrile |
|---|---|
| PubChem CID | 11425869 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 5-[4-(2-aminopropan-2-yl)phenyl]-1H-indazole-3-carbonitrile |
| SMILES | CC(C)(N)c1ccc(-c2ccc3[nH]nc(C#N)c3c2)cc1 |
| InChI | InChI=1S/C17H16N4/c1-17(2,19)13-6-3-11(4-7-13)12-5-8-15-14(9-12)16(10-18)21-20-15/h3-9H,19H2,1-2H3,(H,20,21) |
| InChIKey | KDIGOPQTKOLYPS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |