C20H23N3O2 — CID 70998413
1-[4-(3-amino-1H-indazol-5-yl)phenoxy]-4,4-dimethylpentan-2-one (PubChem CID 70998413) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[4-(3-amino-1H-indazol-5-yl)phenoxy]-4,4-dimethylpentan-2-one.
| Compound Name | 1-[4-(3-amino-1H-indazol-5-yl)phenoxy]-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 70998413 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[4-(3-amino-1H-indazol-5-yl)phenoxy]-4,4-dimethylpentan-2-one |
| SMILES | CC(C)(C)CC(=O)COc1ccc(-c2ccc3[nH]nc(N)c3c2)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-20(2,3)11-15(24)12-25-16-7-4-13(5-8-16)14-6-9-18-17(10-14)19(21)23-22-18/h4-10H,11-12H2,1-3H3,(H3,21,22,23) |
| InChIKey | PWAFMUPPLQWGOM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |