C17H19N3O3 — CID 143156346
2-[4-(3-amino-1H-indazol-5-yl)phenoxy]acetic acid;ethane (PubChem CID 143156346) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-[4-(3-amino-1H-indazol-5-yl)phenoxy]acetic acid;ethane.
| Compound Name | 2-[4-(3-amino-1H-indazol-5-yl)phenoxy]acetic acid;ethane |
|---|---|
| PubChem CID | 143156346 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-[4-(3-amino-1H-indazol-5-yl)phenoxy]acetic acid;ethane |
| SMILES | CC.Nc1n[nH]c2ccc(-c3ccc(OCC(=O)O)cc3)cc12 |
| InChI | InChI=1S/C15H13N3O3.C2H6/c16-15-12-7-10(3-6-13(12)17-18-15)9-1-4-11(5-2-9)21-8-14(19)20;1-2/h1-7H,8H2,(H,19,20)(H3,16,17,18);1-2H3 |
| InChIKey | ASJWQEUYMBFRNH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |