C19H18N6O3 — CID 168610028
tert-butyl 2-oxo-7-(1,2,2-tricyanoethenylamino)-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate (PubChem CID 168610028) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is tert-butyl 2-oxo-7-(1,2,2-tricyanoethenylamino)-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate.
| Compound Name | tert-butyl 2-oxo-7-(1,2,2-tricyanoethenylamino)-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate |
|---|---|
| PubChem CID | 168610028 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | tert-butyl 2-oxo-7-(1,2,2-tricyanoethenylamino)-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)Nc2ccc(NC(C#N)=C(C#N)C#N)cc2C1 |
| InChI | InChI=1S/C19H18N6O3/c1-19(2,3)28-18(27)25-10-12-6-14(4-5-15(12)24-17(26)11-25)23-16(9-22)13(7-20)8-21/h4-6,23H,10-11H2,1-3H3,(H,24,26) |
| InChIKey | JHNCDLDWYQQWBY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|