C16H23N7O3 — CID 168605256
tert-butyl 7-[[amino-(diaminomethylideneamino)methylidene]amino]-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate (PubChem CID 168605256) has the molecular formula C16H23N7O3 and a molecular weight of 361.41 g/mol. Its IUPAC name is tert-butyl 7-[[amino-(diaminomethylideneamino)methylidene]amino]-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate.
| Compound Name | tert-butyl 7-[[amino-(diaminomethylideneamino)methylidene]amino]-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate |
|---|---|
| PubChem CID | 168605256 |
| Molecular Formula | C16H23N7O3 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl 7-[[amino-(diaminomethylideneamino)methylidene]amino]-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)Nc2ccc(/N=C(\N)N=C(N)N)cc2C1 |
| InChI | InChI=1S/C16H23N7O3/c1-16(2,3)26-15(25)23-7-9-6-10(20-14(19)22-13(17)18)4-5-11(9)21-12(24)8-23/h4-6H,7-8H2,1-3H3,(H,21,24)(H6,17,18,19,20,22) |
| InChIKey | XFMSMMPSXNLAPF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 161.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|