C19H20N4O3 — CID 89298066
tert-butyl N-[4-[[(cyanoamino)-phenoxymethylidene]amino]phenyl]carbamate (PubChem CID 89298066) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is tert-butyl N-[4-[[(cyanoamino)-phenoxymethylidene]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(cyanoamino)-phenoxymethylidene]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 89298066 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | tert-butyl N-[4-[[(cyanoamino)-phenoxymethylidene]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(/N=C(\NC#N)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N4O3/c1-19(2,3)26-18(24)23-15-11-9-14(10-12-15)22-17(21-13-20)25-16-7-5-4-6-8-16/h4-12H,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | IATKUPJNGXSVQY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|