C21H24N4O3 — CID 178084259
tert-butyl N-[[4-[[(cyanoamino)-phenoxymethylidene]amino]phenyl]methyl]-N-methylcarbamate (PubChem CID 178084259) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is tert-butyl N-[[4-[[(cyanoamino)-phenoxymethylidene]amino]phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[4-[[(cyanoamino)-phenoxymethylidene]amino]phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 178084259 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | tert-butyl N-[[4-[[(cyanoamino)-phenoxymethylidene]amino]phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1ccc(/N=C(\NC#N)Oc2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H24N4O3/c1-21(2,3)28-20(26)25(4)14-16-10-12-17(13-11-16)24-19(23-15-22)27-18-8-6-5-7-9-18/h5-13H,14H2,1-4H3,(H,23,24) |
| InChIKey | SHVIMXZLMGFICM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|