C10H9F2N3OS — CID 169361785
methyl N-cyano-N'-(3,4-difluoro-2-methoxyphenyl)carbamimidothioate (PubChem CID 169361785) has the molecular formula C10H9F2N3OS and a molecular weight of 257.26 g/mol. Its IUPAC name is methyl N-cyano-N'-(3,4-difluoro-2-methoxyphenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(3,4-difluoro-2-methoxyphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 169361785 |
| Molecular Formula | C10H9F2N3OS |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | methyl N-cyano-N'-(3,4-difluoro-2-methoxyphenyl)carbamimidothioate |
| SMILES | COc1c(/N=C(/NC#N)SC)ccc(F)c1F |
| InChI | InChI=1S/C10H9F2N3OS/c1-16-9-7(4-3-6(11)8(9)12)15-10(17-2)14-5-13/h3-4H,1-2H3,(H,14,15) |
| InChIKey | JVGOAOJSGNVPDN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|