C10H7F4N3S2 — CID 169364190
methyl N-cyano-N'-[2-fluoro-4-(trifluoromethylsulfanyl)phenyl]carbamimidothioate (PubChem CID 169364190) has the molecular formula C10H7F4N3S2 and a molecular weight of 309.31 g/mol. Its IUPAC name is methyl N-cyano-N'-[2-fluoro-4-(trifluoromethylsulfanyl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2-fluoro-4-(trifluoromethylsulfanyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169364190 |
| Molecular Formula | C10H7F4N3S2 |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | methyl N-cyano-N'-[2-fluoro-4-(trifluoromethylsulfanyl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(SC(F)(F)F)cc1F)NC#N |
| InChI | InChI=1S/C10H7F4N3S2/c1-18-9(16-5-15)17-8-3-2-6(4-7(8)11)19-10(12,13)14/h2-4H,1H3,(H,16,17) |
| InChIKey | FWQLFVIAGJCTQA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|