C16H8ClF6N3OS — CID 169364428
methyl N'-[4-chloro-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-2-fluorophenyl]-N-cyanocarbamimidothioate (PubChem CID 169364428) has the molecular formula C16H8ClF6N3OS and a molecular weight of 439.77 g/mol. Its IUPAC name is methyl N'-[4-chloro-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-2-fluorophenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[4-chloro-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-2-fluorophenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169364428 |
| Molecular Formula | C16H8ClF6N3OS |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | methyl N'-[4-chloro-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-2-fluorophenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cc(Oc2c(F)cc(C(F)(F)F)cc2F)c(Cl)cc1F)NC#N |
| InChI | InChI=1S/C16H8ClF6N3OS/c1-28-15(25-6-24)26-12-5-13(8(17)4-9(12)18)27-14-10(19)2-7(3-11(14)20)16(21,22)23/h2-5H,1H3,(H,25,26) |
| InChIKey | ZQPRLKGOBFIEBE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|