C9H9BFN3O2S — CID 169363934
[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-5-fluorophenyl]boronic acid (PubChem CID 169363934) has the molecular formula C9H9BFN3O2S and a molecular weight of 253.07 g/mol. Its IUPAC name is [2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-5-fluorophenyl]boronic acid.
| Compound Name | [2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-5-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 169363934 |
| Molecular Formula | C9H9BFN3O2S |
| Molecular Weight | 253.07 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | [2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-5-fluorophenyl]boronic acid |
| SMILES | CS/C(=N\c1ccc(F)cc1B(O)O)NC#N |
| InChI | InChI=1S/C9H9BFN3O2S/c1-17-9(13-5-12)14-8-3-2-6(11)4-7(8)10(15)16/h2-4,15-16H,1H3,(H,13,14) |
| InChIKey | NXPUIIZLLLPAQC-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.07 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|