C12H12FN3O2S — CID 169360906
methyl N-cyano-N'-[5-fluoro-2-(oxetan-3-yloxy)phenyl]carbamimidothioate (PubChem CID 169360906) has the molecular formula C12H12FN3O2S and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl N-cyano-N'-[5-fluoro-2-(oxetan-3-yloxy)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[5-fluoro-2-(oxetan-3-yloxy)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169360906 |
| Molecular Formula | C12H12FN3O2S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | methyl N-cyano-N'-[5-fluoro-2-(oxetan-3-yloxy)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cc(F)ccc1OC1COC1)NC#N |
| InChI | InChI=1S/C12H12FN3O2S/c1-19-12(15-7-14)16-10-4-8(13)2-3-11(10)18-9-5-17-6-9/h2-4,9H,5-6H2,1H3,(H,15,16) |
| InChIKey | REJXWFOQVUEKBQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|