C14H14FN5OS — CID 169362186
methyl N-cyano-N'-[5-fluoro-2-[(2-methylpyrazol-3-yl)methoxy]phenyl]carbamimidothioate (PubChem CID 169362186) has the molecular formula C14H14FN5OS and a molecular weight of 319.37 g/mol. Its IUPAC name is methyl N-cyano-N'-[5-fluoro-2-[(2-methylpyrazol-3-yl)methoxy]phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[5-fluoro-2-[(2-methylpyrazol-3-yl)methoxy]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169362186 |
| Molecular Formula | C14H14FN5OS |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | methyl N-cyano-N'-[5-fluoro-2-[(2-methylpyrazol-3-yl)methoxy]phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cc(F)ccc1OCc1ccnn1C)NC#N |
| InChI | InChI=1S/C14H14FN5OS/c1-20-11(5-6-18-20)8-21-13-4-3-10(15)7-12(13)19-14(22-2)17-9-16/h3-7H,8H2,1-2H3,(H,17,19) |
| InChIKey | BIXGBWPWYDLHRZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|