C15H14FN3OS2 — CID 169363251
methyl N-cyano-N'-[5-fluoro-2-(2-thiophen-2-ylethoxy)phenyl]carbamimidothioate (PubChem CID 169363251) has the molecular formula C15H14FN3OS2 and a molecular weight of 335.43 g/mol. Its IUPAC name is methyl N-cyano-N'-[5-fluoro-2-(2-thiophen-2-ylethoxy)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[5-fluoro-2-(2-thiophen-2-ylethoxy)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169363251 |
| Molecular Formula | C15H14FN3OS2 |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | methyl N-cyano-N'-[5-fluoro-2-(2-thiophen-2-ylethoxy)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cc(F)ccc1OCCc1cccs1)NC#N |
| InChI | InChI=1S/C15H14FN3OS2/c1-21-15(18-10-17)19-13-9-11(16)4-5-14(13)20-7-6-12-3-2-8-22-12/h2-5,8-9H,6-7H2,1H3,(H,18,19) |
| InChIKey | FCFATCGECNEXMZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|