C12H13N3O3S — CID 169361717
5-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-ethoxybenzoic acid (PubChem CID 169361717) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 5-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-ethoxybenzoic acid.
| Compound Name | 5-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-ethoxybenzoic acid |
|---|---|
| PubChem CID | 169361717 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 5-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-ethoxybenzoic acid |
| SMILES | CCOc1ccc(/N=C(/NC#N)SC)cc1C(=O)O |
| InChI | InChI=1S/C12H13N3O3S/c1-3-18-10-5-4-8(6-9(10)11(16)17)15-12(19-2)14-7-13/h4-6H,3H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | MVAYCBCOXAJTNR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|