C14H16FN3O2S — CID 169362581
methyl N-cyano-N'-[2-fluoro-6-(oxan-4-yloxy)phenyl]carbamimidothioate (PubChem CID 169362581) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl N-cyano-N'-[2-fluoro-6-(oxan-4-yloxy)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2-fluoro-6-(oxan-4-yloxy)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169362581 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | methyl N-cyano-N'-[2-fluoro-6-(oxan-4-yloxy)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1c(F)cccc1OC1CCOCC1)NC#N |
| InChI | InChI=1S/C14H16FN3O2S/c1-21-14(17-9-16)18-13-11(15)3-2-4-12(13)20-10-5-7-19-8-6-10/h2-4,10H,5-8H2,1H3,(H,17,18) |
| InChIKey | UPPZTMVLMIFTSX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|