C8H7F2NO2 — CID 117280590
2-amino-1-(3,6-difluoro-2-hydroxyphenyl)ethanone (PubChem CID 117280590) has the molecular formula C8H7F2NO2 and a molecular weight of 187.15 g/mol. Its IUPAC name is 2-amino-1-(3,6-difluoro-2-hydroxyphenyl)ethanone.
| Compound Name | 2-amino-1-(3,6-difluoro-2-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 117280590 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-amino-1-(3,6-difluoro-2-hydroxyphenyl)ethanone |
| SMILES | NCC(=O)c1c(F)ccc(F)c1O |
| InChI | InChI=1S/C8H7F2NO2/c9-4-1-2-5(10)8(13)7(4)6(12)3-11/h1-2,13H,3,11H2 |
| InChIKey | WWGCDFHKXRVRAF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |