C14H15F3O — CID 114971637
(2,2,3,3-tetramethylcyclopropyl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 114971637) has the molecular formula C14H15F3O and a molecular weight of 256.27 g/mol. Its IUPAC name is (2,2,3,3-tetramethylcyclopropyl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (2,2,3,3-tetramethylcyclopropyl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 114971637 |
| Molecular Formula | C14H15F3O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2,2,3,3-tetramethylcyclopropyl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | CC1(C)C(C(=O)c2ccc(F)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C14H15F3O/c1-13(2)12(14(13,3)4)11(18)7-5-6-8(15)10(17)9(7)16/h5-6,12H,1-4H3 |
| InChIKey | UDCMXWBTRRQPRF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|